Index of /controller/aviation
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | vvv.zip | 2021-11-24 16:07 | 903K | |
![[ ]](/icons/layout.gif) | vvv-converted-conver..> | 2021-11-24 18:06 | 957K | |
| vol-1, issue-6.pdf | 2021-10-05 14:47 | 769K | |
| uses of organometall..> | 2022-03-30 23:38 | 576K | |
| two dimensional anal..> | 2021-11-09 23:07 | 590K | |
| thermodynamic analys..> | 2021-10-05 14:47 | 537K | |
| test-document-pdf.pdf | 2021-10-05 14:47 | 75K | |
| technical roadmap (R..> | 2021-11-24 16:10 | 875K | |
| technical.pdf | 2021-11-24 16:17 | 875K | |
![[IMG]](/icons/image2.gif) | take-a-look-inside-t..> | 2021-10-05 14:47 | 699K | |
| studies on isolation..> | 2021-10-05 14:47 | 1.2M | |
| single-img.jpg | 2021-10-05 14:47 | 54K | |
| sample - copia_0.pdf | 2021-10-05 14:47 | 18K | |
| resupdf.pdf | 2021-11-24 16:15 | 88K | |
| performance evaluati..> | 2021-10-05 14:47 | 309K | |
| mo.jpg | 2021-10-05 14:47 | 41K | |
| methods for improvin..> | 2021-10-05 14:47 | 371K | |
![[ ]](/icons/unknown.gif) | login registration.php | 2021-10-05 14:47 | 1.4K | |
| hub4tech26.docx | 2021-10-05 14:47 | 13K | |
| gym_625x350_61452066..> | 2021-10-05 14:47 | 35K | |
| friction stir weldin..> | 2021-10-05 14:47 | 381K | |
| experimental investi..> | 2021-10-05 14:47 | 450K | |
| example_4.pdf | 2021-10-05 14:46 | 78K | |
| effect of compressio..> | 2021-10-05 14:46 | 516K | |
| effect of Different ..> | 2021-11-09 23:22 | 1.3M | |
| edit_submit.php | 2021-10-05 14:46 | 11K | |
| edit_issue.php | 2021-10-05 14:46 | 10K | |
| edit_editorial.php | 2021-10-05 14:46 | 11K | |
| edit_archive.php | 2021-10-05 14:46 | 10K | |
| dummy.pdf | 2022-12-30 10:33 | 13K | |
| download.jpg | 2021-10-05 14:46 | 9.6K | |
| download (1).jpg | 2021-10-05 14:46 | 12K | |
| crud-with-pdo-and-oo..> | 2021-10-05 14:46 | 29K | |
| concentrated solar t..> | 2021-11-09 22:49 | 848K | |
![[TXT]](/icons/text.gif) | bootstrap.css | 2021-10-05 14:46 | 138K | |
| bi.pdf | 2021-10-05 14:46 | 2.8M | |
| banner.jpeg | 2021-10-05 14:46 | 38K | |
| a review of dissimil..> | 2023-05-14 15:43 | 1.1M | |
| a review of dissimil..> | 2023-03-17 16:30 | 1.1M | |
| apna-hathras.jpg | 2021-10-05 14:46 | 124K | |
| a comprehensive anal..> | 2022-08-14 12:10 | 957K | |
| academic-calendar.pdf | 2021-10-05 14:46 | 63K | |
| [34] Vol-1, Issue-6.pdf | 2021-10-23 17:42 | 446K | |
| [33] Vol-1, Issue-6.pdf | 2021-10-23 17:42 | 627K | |
| [32] Vol-1, Issue-6.pdf | 2021-10-23 17:42 | 725K | |
| [31] vol-1, issue-6.pdf | 2021-10-23 17:41 | 505K | |
| [29] vol-1 issue-3 .pdf | 2021-10-12 22:03 | 551K | |
| [29] vol-1, issue-6.pdf | 2021-10-23 17:39 | 663K | |
| [28] vol-1 issue-3 .pdf | 2021-10-12 22:03 | 1.1M | |
| [27] vol-1 issue-3 .pdf | 2021-10-12 22:03 | 443K | |
| [27] vol-1, issue-6.pdf | 2021-10-23 17:38 | 670K | |
| [26] vol-1 issue-3.pdf | 2021-10-12 22:03 | 2.3M | |
| [26] vol-1, issue-6.pdf | 2021-10-23 17:38 | 412K | |
| [25] vol-1 issue-3.pdf | 2021-10-12 22:02 | 355K | |
| [25] vol-1, issue-6.pdf | 2021-10-23 17:38 | 445K | |
| [24] vol-1 issue-3.pdf | 2021-10-12 22:02 | 500K | |
| [24] vol-1, issue-6.pdf | 2021-10-23 17:37 | 452K | |
| [23] vol-1 issue-3.pdf | 2021-10-12 22:02 | 832K | |
| [22] vol-1 issue-3.pdf | 2021-10-12 22:02 | 1.3M | |
| [22] vol-1, issue-6.pdf | 2021-10-23 17:37 | 629K | |
| [21] vol-1 issue-3.pdf | 2021-10-12 22:01 | 801K | |
| [21] vol-1, issue-6.pdf | 2021-10-23 17:36 | 348K | |
| [20] vol-1 issue-3 .pdf | 2021-10-12 22:01 | 439K | |
| [20] vol-1, issue-6.pdf | 2021-10-23 17:36 | 456K | |
| [20] vol-1, issue-4 ..> | 2021-10-12 21:14 | 794K | |
| [19] vol-1 issue-3 .pdf | 2021-10-12 22:01 | 860K | |
| [19] vol-1, issue-6.pdf | 2021-10-23 17:36 | 1.1M | |
| [19] vol-1, issue-4 ..> | 2021-10-12 21:14 | 418K | |
| [18] vol-1 issue-3.pdf | 2021-10-12 22:00 | 648K | |
| [18] vol-1, issue-6.pdf | 2021-10-23 17:35 | 844K | |
| [17] vol-1 issue-3.pdf | 2021-10-12 22:00 | 689K | |
| [17] vol-1, issue-6.pdf | 2021-10-23 17:35 | 602K | |
| [17] vol-1, issue-4.pdf | 2021-10-12 21:14 | 953K | |
| [16] vol-1 issue-3.pdf | 2021-10-12 22:00 | 573K | |
| [16] vol-1, issue-6.pdf | 2021-10-23 17:35 | 869K | |
| [16] vol-1, issue-4 ..> | 2021-10-12 21:13 | 272K | |
| [15] vol-1 issue-3.pdf | 2021-10-12 21:59 | 514K | |
| [15] vol-1, issue-6.pdf | 2021-10-23 17:34 | 1.3M | |
| [15] vol-1, issue-4 ..> | 2021-10-12 21:13 | 744K | |
| [14] vol-1 issue-3 .pdf | 2021-10-12 21:59 | 436K | |
| [14] vol-1, issue-6.pdf | 2021-10-23 17:34 | 492K | |
| [14] vol-1, issue-4.pdf | 2021-10-12 21:13 | 1.0M | |
| [13] vol-1, issue-6.pdf | 2021-10-23 17:34 | 528K | |
| [13] vol-1, issue-4.pdf | 2021-10-12 21:13 | 679K | |
| [12] vol-1 issue-3.pdf | 2021-10-12 21:59 | 419K | |
| [12] vol-1, issue-6.pdf | 2021-10-23 17:33 | 427K | |
| [12] vol-1, issue-4.pdf | 2021-10-12 21:12 | 957K | |
| [12] IJREI_vol-1, Is..> | 2021-10-12 22:08 | 567K | |
| [11] vol-1 issue-3 .pdf | 2021-10-12 21:58 | 372K | |
| [11] vol-1, issue-6.pdf | 2021-10-23 17:33 | 462K | |
| [11] vol-1, issue-4.pdf | 2021-10-12 21:12 | 3.4M | |
| [11] IJREI_vol-1, Is..> | 2021-10-12 22:08 | 805K | |
| [10] vol-1 issue-3.pdf | 2021-10-12 21:58 | 417K | |
| [10] vol-1, issue-6.pdf | 2021-10-23 17:33 | 621K | |
| [10] vol-1, issue-5.pdf | 2021-10-12 21:07 | 409K | |
| [10] vol-1, issue-4.pdf | 2021-10-12 21:11 | 1.1M | |
| [10] IJREI_vol-1, Is..> | 2021-10-12 22:08 | 661K | |
| [9] vol-1 issue-3.pdf | 2021-10-12 21:58 | 394K | |
| [9] vol-1, issue-6.pdf | 2021-10-23 17:32 | 393K | |
| [9] vol-1, issue-5.pdf | 2021-10-12 21:06 | 823K | |
| [9] vol-1, issue-4.pdf | 2021-10-12 21:11 | 467K | |
| [9] IJREI_vol-1, Iss..> | 2021-10-12 22:08 | 283K | |
| [8] vol-1 issue-3.pdf | 2021-10-12 21:57 | 633K | |
| [8] vol-1, issue-6.pdf | 2021-10-23 17:31 | 335K | |
| [8] vol-1, issue-5.pdf | 2021-10-12 21:06 | 439K | |
| [8] vol-1, issue-4.pdf | 2021-10-12 21:11 | 452K | |
| [8] IJREI_vol-1, Iss..> | 2021-10-12 22:07 | 363K | |
| [7] vol-1 issue-3 .pdf | 2021-10-12 21:57 | 632K | |
| [7] vol-1, issue-6.pdf | 2021-10-23 17:30 | 412K | |
| [7] vol-1, issue-5.pdf | 2021-10-12 21:06 | 281K | |
| [7] IJREI_vol-1, Iss..> | 2021-10-12 22:07 | 413K | |
| [6] vol-1 issue-3.pdf | 2021-10-12 21:57 | 1.0M | |
| [6] vol-1, issue-6 .pdf | 2021-10-23 17:29 | 319K | |
| [6] vol-1, issue-5.pdf | 2021-10-12 21:06 | 1.7M | |
| [6] Vol-7, Issue-6.pdf | 2023-12-17 11:22 | 408K | |
| [6] IJREI_vol-1, Iss..> | 2021-10-12 22:07 | 843K | |
| [6] IJREI_V-1_Issue-..> | 2021-10-12 15:12 | 533K | |
| [5] vol-1 issue-3 .pdf | 2021-10-12 21:56 | 803K | |
| [5] vol-1, issue-6.pdf | 2021-10-23 17:28 | 483K | |
| [5] vol-1, issue-5.pdf | 2021-10-12 21:05 | 713K | |
| [5] vol-1, issue-4.pdf | 2021-10-12 21:09 | 701K | |
| [5] IJREI_vol-1, Iss..> | 2021-10-12 22:07 | 506K | |
| [5] IJREI_V-1_Issue-..> | 2021-10-12 15:12 | 720K | |
| [4] vol-1 issue-3 .pdf | 2021-10-12 21:56 | 337K | |
| [4] vol-1, issue-6.pdf | 2021-10-23 17:28 | 820K | |
| [4] vol-1, issue-5.pdf | 2021-10-12 21:05 | 1.0M | |
| [4] vol-1, issue-4.pdf | 2021-10-12 21:09 | 635K | |
| [4] Vol-8, Issue-1.pdf | 2024-01-08 10:17 | 392K | |
| [4] IJREI_vol-1, Iss..> | 2021-10-12 22:06 | 268K | |
| [4] IJREI_V-1_Issue-..> | 2021-10-12 15:11 | 683K | |
| [3] vol-1 issue-3.pdf | 2021-10-12 21:56 | 341K | |
| [3] vol-1, issue-5.pdf | 2021-10-12 21:05 | 925K | |
| [3] vol-1, issue-4.pdf | 2021-10-12 21:09 | 1.3M | |
| [3] IJREI_vol-1, Iss..> | 2021-10-12 22:06 | 410K | |
| [3] IJREI_V-1_Issue-..> | 2021-10-12 15:11 | 929K | |
| [2] vol-1 issue-3.pdf | 2021-10-12 21:56 | 628K | |
| [2] vol-1, issue-6.pdf | 2021-10-23 17:26 | 368K | |
| [2] vol-1, issue-5.pdf | 2021-10-12 21:05 | 1.0M | |
| [2] vol-1, issue-4.pdf | 2021-10-12 21:09 | 554K | |
| [2] Vibration Analys..> | 2021-10-05 14:47 | 661K | |
| [2] IJREI_vol-1, Iss..> | 2021-10-12 22:05 | 1.2M | |
| [2] IJREI_V-1_Issue-..> | 2021-10-12 15:10 | 660K | |
| [1] vol-1 issue-3.pdf | 2021-10-12 21:55 | 626K | |
| [1] vol-1, issue-5 .pdf | 2021-10-12 21:04 | 633K | |
| [1] vol-1, issue-4.pdf | 2021-10-12 21:09 | 505K | |
| [1] Vol-2, Issue-1.pdf | 2021-10-12 20:58 | 594K | |
| [1] IJREI_vol-1, Iss..> | 2021-10-12 22:05 | 457K | |
| Why the three laws o..> | 2021-10-12 20:55 | 458K | |
| Vibration Analysis a..> | 2021-10-05 14:47 | 1.3M | |
| Various analytical m..> | 2021-10-12 20:29 | 563K | |
| Variation of wind lo..> | 2023-10-28 15:39 | 501K | |
| Validation of variou..> | 2021-10-12 21:03 | 800K | |
| Using metal nanopart..> | 2024-03-04 09:37 | 375K | |
| Use of fourth genera..> | 2021-10-05 14:47 | 278K | |
| Trends analysis of b..> | 2021-10-12 20:55 | 298K | |
| Trend of land price ..> | 2021-11-30 18:17 | 824K | |
| Treatment of water f..> | 2023-03-17 15:54 | 557K | |
| Transformation techn..> | 2021-10-12 20:12 | 411K | |
| To study the mechani..> | 2024-05-02 15:12 | 881K | |
| TiO2 carbon dot comp..> | 2021-10-12 20:33 | 1.0M | |
| Three Energy Exergy ..> | 2022-06-13 22:54 | 1.4M | |
| The role of studying..> | 2022-04-07 16:29 | 715K | |
| Thermophysical prope..> | 2023-12-17 19:34 | 351K | |
| Thermo economic opti..> | 2021-11-09 23:12 | 840K | |
| Thermodynamic static..> | 2022-01-01 21:31 | 1.2M | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 355K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 370K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 370K | |
| Thermodynamic perfor..> | 2022-06-06 17:19 | 765K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 409K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 408K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 737K | |
| Thermodynamic perfor..> | 2021-11-09 23:00 | 834K | |
| Thermodynamic perfor..> | 2022-10-29 20:10 | 758K | |
| Thermodynamic perfor..> | 2022-06-13 18:05 | 763K | |
| Thermodynamic perfor..> | 2022-03-09 14:30 | 765K | |
| Thermodynamic perfor..> | 2021-11-09 23:12 | 678K | |
| Thermodynamic perfor..> | 2023-03-17 15:48 | 1.3M | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 283K | |
| Thermodynamic perfor..> | 2021-10-23 17:43 | 199K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 882K | |
| Thermodynamic perfor..> | 2021-11-09 23:32 | 464K | |
| Thermodynamic perfor..> | 2021-11-09 23:35 | 464K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 682K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 914K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 185K | |
| Thermodynamic perfor..> | 2021-10-05 14:47 | 528K | |
| Thermodynamic models..> | 2021-10-12 20:51 | 1.3M | |
| Thermodynamic model ..> | 2021-10-05 14:47 | 453K | |
| Thermodynamic exergy..> | 2021-11-09 22:59 | 667K | |
| Thermodynamic analys..> | 2023-03-17 15:43 | 1.0M | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 304K | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 396K | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 1.0M | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 1.0M | |
| Thermodynamic analys..> | 2021-10-12 20:46 | 1.0M | |
| Thermodynamic analys..> | 2022-03-09 14:29 | 606K | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 747K | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 630K | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 780K | |
| Thermodynamic analys..> | 2021-10-12 21:00 | 480K | |
| Thermodynamic analys..> | 2021-10-12 20:57 | 283K | |
| Thermodynamic analys..> | 2021-10-05 14:47 | 1.4M | |
| Thermodynamic analys..> | 2021-10-12 20:35 | 710K | |
| Thermodynamic analys..> | 2021-10-12 20:47 | 366K | |
| Thermodynamic Energy..> | 2023-03-17 15:57 | 1.3M | |
| Thermodynamic (energ..> | 2023-03-17 16:28 | 482K | |
| Thermodynamic (energ..> | 2023-05-14 15:43 | 482K | |
| Thermodynamic (energ..> | 2021-10-05 14:47 | 506K | |
| Thermodynamic (energ..> | 2023-03-17 15:52 | 1.6M | |
| Thermodynamic (energ..> | 2021-10-12 21:02 | 433K | |
| Thermo-economic anal..> | 2021-11-09 23:07 | 402K | |
| Thermal performances..> | 2023-11-29 16:01 | 517K | |
| Thermal performances..> | 2021-10-05 14:47 | 572K | |
| Thermal performances..> | 2021-10-05 14:47 | 572K | |
| Thermal performance ..> | 2023-05-14 15:36 | 1.0M | |
| Thermal performance ..> | 2023-05-14 15:38 | 1.0M | |
| Thermal performance ..> | 2021-10-05 14:47 | 570K | |
| Thermal performance ..> | 2021-10-05 14:47 | 613K | |
| Thermal performance ..> | 2021-10-12 20:42 | 436K | |
| Thermal performance ..> | 2021-10-05 14:47 | 469K | |
| Thermal performance ..> | 2021-11-09 23:06 | 609K | |
| Thermal performance ..> | 2021-11-09 22:58 | 724K | |
| Thermal modelling an..> | 2021-10-05 14:47 | 513K | |
| Thermal analysis of ..> | 2021-10-12 20:59 | 428K | |
| Thermal Performance ..> | 2021-10-05 14:47 | 586K | |
| The kinematic analys..> | 2021-11-09 23:12 | 727K | |
| The effect of nutrit..> | 2023-05-14 15:45 | 507K | |
| The effect of nutrit..> | 2023-04-03 09:32 | 507K | |
| The analysis of the ..> | 2021-10-12 20:08 | 339K | |
| Technical and cost a..> | 2021-10-05 14:47 | 1.1M | |
| Synthesis and applic..> | 2023-03-17 15:59 | 752K | |
| Support vector machi..> | 2021-10-12 20:42 | 358K | |
| Study the mechanical..> | 2022-03-11 16:16 | 762K | |
| Study the mechanical..> | 2022-03-11 16:17 | 762K | |
| Study of wireless se..> | 2021-10-12 20:50 | 390K | |
| Study of the dominan..> | 2021-11-09 23:06 | 1.1M | |
| Study of self-compac..> | 2021-10-12 20:06 | 311K | |
| Study of Solar opera..> | 2021-11-30 11:47 | 383K | |
| Study and survey on ..> | 2022-06-06 17:54 | 813K | |
| Study and survey on ..> | 2022-06-06 17:56 | 813K | |
| Studies on obtaining..> | 2021-10-12 20:59 | 596K | |
| Solid waste issue So..> | 2021-12-06 16:19 | 389K | |
| Solar powered operat..> | 2023-05-20 11:49 | 833K | |
| Solar powered operat..> | 2023-05-23 16:51 | 833K | |
| Solar energy and its..> | 2021-11-09 23:31 | 481K | |
| Solar energy and its..> | 2021-11-09 23:34 | 481K | |
| Single and multiple ..> | 2021-10-05 14:47 | 442K | |
| Simulation of load b..> | 2022-03-30 23:42 | 1.0M | |
| Seismic response of ..> | 2023-03-17 16:09 | 243K | |
| Security analysis of..> | 2023-03-17 15:56 | 1.3M | |
| Securing the interne..> | 2023-12-27 20:33 | 299K | |
| Search for ecofriend..> | 2021-10-05 14:47 | 536K | |
| Search for ecofriend..> | 2021-10-05 14:47 | 536K | |
| Role of surface roug..> | 2021-11-09 23:07 | 639K | |
| Role of image proces..> | 2024-05-02 13:06 | 202K | |
| Role of image proces..> | 2024-05-02 15:01 | 202K | |
| Role of image proces..> | 2024-05-02 15:02 | 202K | |
| Role of image proces..> | 2024-05-02 15:06 | 202K | |
| Role of analytical c..> | 2021-10-12 20:03 | 537K | |
| Role of Nano technol..> | 2021-10-05 14:47 | 499K | |
| Review on spectrosco..> | 2021-10-12 20:10 | 466K | |
| Review of organotin ..> | 2021-10-12 20:48 | 552K | |
| Response of base–i..> | 2023-11-22 16:45 | 728K | |
| Reduce antibacterial..> | 2024-01-08 09:50 | 473K | |
| Recent advances in f..> | 2023-03-18 15:51 | 908K | |
| Recent advances in f..> | 2023-03-18 15:52 | 908K | |
| Recent advance in fr..> | 2023-05-14 15:44 | 908K | |
| Quality of service a..> | 2021-12-11 13:43 | 692K | |
| Public private partn..> | 2021-10-12 21:03 | 302K | |
| Proposal for Website..> | 2021-10-23 11:58 | 1.0M | |
| Properties of gsp-Ha..> | 2021-10-12 20:48 | 310K | |
| Possibilities of giv..> | 2021-10-12 20:03 | 138K | |
| Performances evaluat..> | 2023-08-06 14:04 | 548K | |
| Performance parametr..> | 2021-10-05 14:47 | 1.1M | |
| Performance paramete..> | 2021-10-23 18:31 | 488K | |
| Performance of F.S.G..> | 2021-11-09 23:42 | 1.1M | |
| Performance measurem..> | 2021-10-12 20:33 | 326K | |
| Performance improvem..> | 2021-10-05 14:47 | 711K | |
| Performance improvem..> | 2021-10-12 20:42 | 310K | |
| Performance improvem..> | 2021-10-12 20:08 | 309K | |
| Performance improvem..> | 2021-10-12 21:01 | 581K | |
| Performance evaluati..> | 2021-10-12 20:36 | 584K | |
| Performance evaluati..> | 2021-10-05 14:47 | 390K | |
| Performance evaluati..> | 2021-10-05 14:47 | 430K | |
| Performance evaluati..> | 2021-10-12 20:05 | 292K | |
| Performance evaluati..> | 2021-10-05 14:47 | 721K | |
| Performance evaluati..> | 2021-11-09 23:42 | 1.0M | |
| Performance evaluati..> | 2021-10-05 14:47 | 808K | |
| Performance evaluati..> | 2021-10-05 14:47 | 456K | |
| Performance evaluati..> | 2021-10-05 14:47 | 454K | |
| Performance evaluati..> | 2021-11-09 22:45 | 550K | |
| Performance evaluati..> | 2021-10-05 14:47 | 703K | |
| Performance evaluati..> | 2021-10-05 14:47 | 284K | |
| Performance evaluati..> | 2021-10-05 14:47 | 540K | |
| Performance evaluati..> | 2021-10-05 14:47 | 461K | |
| Performance evaluati..> | 2021-11-09 22:47 | 556K | |
| Performance evaluati..> | 2021-10-05 14:47 | 194K | |
| Performance enhancem..> | 2021-10-23 17:43 | 337K | |
| Performance analysis..> | 2021-10-05 14:47 | 684K | |
| Performance analysis..> | 2021-10-05 14:47 | 613K | |
| Payment.pdf | 2021-10-23 12:11 | 273K | |
| Parametric study of ..> | 2021-11-09 23:28 | 896K | |
| Parametric evaluatio..> | 2021-10-05 14:47 | 1.5M | |
| Overview on computat..> | 2021-11-24 19:02 | 783K | |
| Overview on computat..> | 2021-11-24 19:10 | 783K | |
| Overview of the evol..> | 2023-11-17 22:29 | 554K | |
| Optimum thermodynami..> | 2021-10-05 14:47 | 342K | |
| Optimum performance ..> | 2021-10-05 14:47 | 679K | |
| Optimum performance ..> | 2021-10-05 14:47 | 677K | |
| Optimization of ultr..> | 2021-11-09 23:46 | 1.0M | |
| Optimization of ultr..> | 2021-11-09 23:45 | 1.0M | |
| Optimization of ther..> | 2023-07-06 18:48 | 700K | |
| Optimization of the ..> | 2021-10-12 20:38 | 918K | |
| Optimization of supp..> | 2021-10-12 20:06 | 237K | |
| Optimization of proc..> | 2023-12-11 22:41 | 1.0M | |
| Optimization of proc..> | 2022-07-29 10:43 | 1.2M | |
| Optimization of proc..> | 2023-03-17 15:45 | 1.2M | |
| Optimization of proc..> | 2022-08-11 22:07 | 1.6M | |
| Optimization of proc..> | 2021-10-05 14:47 | 1.4M | |
| Optimization of proc..> | 2021-10-05 14:47 | 1.0M | |
| Optimization of proc..> | 2021-10-05 14:47 | 1.0M | |
| Optimization of proc..> | 2021-10-05 14:47 | 1.0M | |
| Optimization of proc..> | 2022-08-11 22:08 | 1.6M | |
| Optimization of proc..> | 2021-10-05 14:47 | 1.2M | |
| Optimization of proc..> | 2021-11-09 23:11 | 1.3M | |
| Optimization of Proc..> | 2021-10-12 20:29 | 656K | |
| Optimization of FSW ..> | 2024-01-08 15:50 | 1.2M | |
| Opportunities and ch..> | 2021-10-05 14:47 | 270K | |
| Opportunities and ch..> | 2021-10-05 14:47 | 270K | |
| Nurses’ knowledge ..> | 2023-11-29 22:20 | 470K | |
| Numerical validation..> | 2021-10-12 20:49 | 1.0M | |
| Numerical investigat..> | 2023-03-17 16:21 | 385K | |
| Numerical investigat..> | 2021-10-12 13:40 | 610K | |
| Numerical analysis a..> | 2021-10-12 20:29 | 1.0M | |
| Non-traditional opti..> | 2021-10-12 20:40 | 416K | |
| New methods to enhan..> | 2021-10-05 14:47 | 377K | |
| New methods to enhan..> | 2021-10-05 14:47 | 377K | |
| New methods to enhan..> | 2021-10-05 14:47 | 297K | |
| New & low GWP eco-fr..> | 2021-10-05 14:47 | 279K | |
| Nanocomposites appli..> | 2023-11-21 12:15 | 436K | |
| Multiple output dc-d..> | 2021-10-12 20:07 | 1.4M | |
| Multi-purpose hybrid..> | 2021-11-09 22:49 | 670K | |
| Molecular purificati..> | 2024-03-01 20:25 | 482K | |
| Modified vapour comp..> | 2024-05-20 16:35 | 388K | |
| Modelling of vapour ..> | 2021-10-05 14:47 | 201K | |
| Modelling of vapour ..> | 2021-10-05 14:47 | 220K | |
| Modeling of deioniza..> | 2023-03-17 15:41 | 1.1M | |
| Modeling of dehydrat..> | 2021-11-09 23:30 | 1.1M | |
| Modeling desulfuriza..> | 2021-10-05 14:47 | 631K | |
| Modeling and simulat..> | 2021-10-05 14:47 | 727K | |
| Microstructure and m..> | 2023-03-17 15:47 | 1.2M | |
| Microstructure and m..> | 2021-10-12 21:02 | 848K | |
| Microbial enzymes-th..> | 2022-03-30 23:39 | 789K | |
| Methods of improving..> | 2023-07-14 23:05 | 522K | |
| Methods for improvin..> | 2021-11-09 23:11 | 1.0M | |
| Methods for improvin..> | 2021-10-12 20:37 | 480K | |
| Methods for improvin..> | 2021-10-05 14:47 | 336K | |
| Methods for improvin..> | 2021-10-05 14:47 | 336K | |
| Methods for improvin..> | 2021-10-05 14:47 | 567K | |
| Methods for improvin..> | 2024-03-25 22:29 | 850K | |
| Methods for enhancin..> | 2021-10-05 14:47 | 290K | |
| Methods for enhancin..> | 2023-05-19 12:17 | 648K | |
| Methods for enhancin..> | 2021-10-05 14:47 | 322K | |
| Method for improving..> | 2021-10-05 14:47 | 762K | |
| Method for enhancing..> | 2024-06-09 21:45 | 424K | |
| Meta heuristic optim..> | 2021-10-12 20:34 | 248K | |
| Mechanical character..> | 2021-11-09 23:24 | 2.0M | |
| Mechanical character..> | 2021-11-24 17:54 | 2.0M | |
| Mechanical character..> | 2021-10-12 20:34 | 1.2M | |
| Mechanical And Micro..> | 2021-10-12 20:45 | 1.2M | |
| Mapping of land use ..> | 2021-10-12 20:44 | 538K | |
| Local chemical compo..> | 2024-02-18 22:46 | 483K | |
| Load frequency contr..> | 2022-08-06 11:57 | 783K | |
| Load balancing algor..> | 2021-10-23 18:35 | 135K | |
| Lean applications in..> | 2021-10-05 14:47 | 153K | |
| Irreversibility anal..> | 2021-10-05 14:47 | 559K | |
| Irreversibility anal..> | 2021-10-05 14:47 | 660K | |
| Iraqi newborns morta..> | 2021-11-09 23:02 | 740K | |
| Investigation of vec..> | 2021-10-05 14:47 | 869K | |
| Investigation of vec..> | 2021-10-12 20:49 | 901K | |
| Investigation of mic..> | 2022-08-11 22:22 | 1.3M | |
| Investigation of mec..> | 2021-10-05 14:47 | 630K | |
| Investigation of mec..> | 2021-10-05 14:47 | 634K | |
| Influence of process..> | 2021-10-05 14:47 | 1.8M | |
| Influence of Zn cont..> | 2021-10-23 18:36 | 1.3M | |
| Improving the implem..> | 2021-10-05 14:47 | 479K | |
| Implication of onlin..> | 2023-03-17 16:00 | 429K | |
| Implementation of a ..> | 2021-10-05 14:47 | 968K | |
| Implementation of a ..> | 2021-11-27 20:11 | 901K | |
| Implementation of a ..> | 2021-10-23 17:17 | 901K | |
| Impact of business p..> | 2021-10-12 21:00 | 504K | |
| Identification and s..> | 2021-10-05 14:47 | 540K | |
| Hybrid power plant w..> | 2022-10-29 20:11 | 492K | |
| Hybrid power plant w..> | 2023-03-17 16:04 | 363K | |
| Human resource manag..> | 2021-10-12 20:53 | 515K | |
| Human-caused effect ..> | 2021-10-05 14:47 | 1.0M | |
| Heat treatment effec..> | 2021-10-12 20:32 | 636K | |
| Heat transfer enhanc..> | 2021-10-12 20:35 | 669K | |
| Groundwater quality ..> | 2023-03-20 22:23 | 534K | |
| Groundwater quality ..> | 2023-05-14 15:45 | 534K | |
| Gold Nanoparticles- ..> | 2021-10-12 20:52 | 301K | |
| Friction stir weldin..> | 2021-10-12 20:54 | 285K | |
| Friction stir weldin..> | 2021-10-05 14:47 | 701K | |
| Finite element heat ..> | 2021-10-12 20:56 | 494K | |
| FMS scheduling using..> | 2021-10-12 20:37 | 662K | |
| Experimental study o..> | 2023-03-17 15:44 | 588K | |
| Experimental analysi..> | 2021-10-05 14:47 | 616K | |
| Experimental analysi..> | 2021-10-12 20:34 | 1.7M | |
| Experimental analysi..> | 2021-10-05 14:47 | 1.4M | |
| Experimental analysi..> | 2021-11-09 23:01 | 1.1M | |
| Experimental & theor..> | 2021-10-05 14:47 | 1.4M | |
| Exergy destruction c..> | 2021-10-05 14:47 | 477K | |
| Exergy and sustainab..> | 2021-10-05 14:47 | 641K | |
| Exergy analysis of s..> | 2021-10-05 14:47 | 295K | |
| Exergy analysis of s..> | 2021-10-05 14:47 | 294K | |
| Exergy analysis of s..> | 2022-02-06 15:38 | 1.1M | |
| Exergetic performanc..> | 2021-10-05 14:47 | 430K | |
| Exergetic performanc..> | 2021-10-12 19:17 | 514K | |
| Evaluation of thermo..> | 2022-01-01 21:33 | 696K | |
| Evaluation of thermo..> | 2021-10-05 14:47 | 1.3M | |
| Evaluation of Unsupe..> | 2024-03-13 11:41 | 1.6M | |
| Estimating the level..> | 2023-10-30 12:11 | 476K | |
| Estimating the level..> | 2023-10-30 12:10 | 476K | |
| Environmental health..> | 2021-10-12 20:52 | 751K | |
| Enhancing the therma..> | 2024-02-22 22:31 | 282K | |
| Enhancements in mech..> | 2021-10-05 14:46 | 308K | |
| Energy and exergy an..> | 2021-10-05 14:46 | 886K | |
| Energy and exergy an..> | 2021-10-05 14:46 | 886K | |
| Energy-exergy perfor..> | 2021-10-05 14:46 | 454K | |
| Energy-exergy perfor..> | 2021-10-12 20:09 | 454K | |
| Energy-exergy perfor..> | 2023-08-27 13:07 | 600K | |
| Energy & Exergy anal..> | 2021-10-05 14:46 | 1.0M | |
| Electrochemical sens..> | 2021-11-24 18:18 | 515K | |
| Electrical and struc..> | 2021-10-12 20:57 | 707K | |
| Effect of zinc amoun..> | 2021-10-12 20:03 | 744K | |
| Effect of silica fum..> | 2024-04-08 15:55 | 716K | |
| Effect of silica fum..> | 2024-04-07 00:04 | 716K | |
| Effect of replacing ..> | 2024-02-12 11:34 | 409K | |
| Effect of processing..> | 2022-03-05 18:35 | 1.4M | |
| Effect of performanc..> | 2021-10-05 14:46 | 602K | |
| Effect of performanc..> | 2021-10-05 14:46 | 580K | |
| Effect of nanopartic..> | 2023-05-14 15:37 | 1.3M | |
| Effect of nanopartic..> | 2023-05-27 23:35 | 1.2M | |
| Effect of multipass ..> | 2024-06-20 23:39 | 949K | |
| Effect of multipass ..> | 2023-03-17 15:46 | 1.3M | |
| Effect of mediation ..> | 2021-11-24 18:16 | 673K | |
| Effect of fuel injec..> | 2021-10-05 14:46 | 507K | |
| Effect of different ..> | 2023-02-20 14:42 | 940K | |
| Effect of different ..> | 2023-03-17 16:15 | 278K | |
| Effect of critical s..> | 2021-11-24 16:29 | 901K | |
| Effect of SiC partic..> | 2022-08-11 22:28 | 1.3M | |
| Effect of SiC partic..> | 2022-08-11 22:29 | 1.3M | |
| Effect of Oral Dosag..> | 2023-08-15 18:49 | 453K | |
| EOQ model for cubic ..> | 2021-11-09 23:26 | 778K | |
| Dynamic control of p..> | 2021-10-05 14:46 | 1.2M | |
| Dynamic analysis of ..> | 2021-11-09 23:23 | 550K | |
| Dye-Sensitized Solar..> | 2022-02-01 12:53 | 783K | |
| Different analytical..> | 2021-10-12 20:09 | 436K | |
| Development of surfa..> | 2021-10-12 20:46 | 792K | |
| Development of mathe..> | 2021-10-05 14:46 | 761K | |
| Determination of tri..> | 2021-10-12 20:11 | 364K | |
| Determination of dru..> | 2021-10-05 14:46 | 1.5M | |
| Design of power driv..> | 2021-10-12 20:43 | 943K | |
| Design of nail makin..> | 2021-10-12 20:39 | 518K | |
| Design of mechanical..> | 2022-06-08 18:25 | 796K | |
| Design of customized..> | 2021-10-05 14:46 | 586K | |
| Designing of Cascade..> | 2021-10-05 14:46 | 524K | |
| Design and fabricati..> | 2022-06-06 17:54 | 949K | |
| Design and fabricati..> | 2022-06-06 17:52 | 949K | |
| Design and developme..> | 2022-04-26 16:45 | 1.0M | |
| Design, optimization..> | 2021-10-12 20:01 | 1.0M | |
| Concrete mix design ..> | 2021-11-09 23:24 | 754K | |
| Computational analys..> | 2021-10-05 14:46 | 1.1M | |
| Comparison of thermo..> | 2023-03-17 16:11 | 171K | |
| Comparison of thermo..> | 2023-01-19 13:38 | 171K | |
| Comparison of therma..> | 2021-10-05 14:46 | 768K | |
| Comparison of therma..> | 2023-07-14 17:48 | 412K | |
| Comparison of the ph..> | 2022-08-12 17:11 | 850K | |
| Comparison of the ph..> | 2023-03-17 15:51 | 850K | |
| Comparison of half e..> | 2021-10-05 14:46 | 254K | |
| Comparative study on..> | 2021-10-12 21:03 | 450K | |
| Comparative study of..> | 2021-10-12 20:04 | 1.0M | |
| Comparative analysis..> | 2021-10-05 14:46 | 1.0M | |
| Combustion performan..> | 2021-10-05 14:46 | 667K | |
| Combustion performan..> | 2021-10-05 14:46 | 670K | |
| Cloud point extracti..> | 2021-10-12 20:10 | 471K | |
| Characterization of ..> | 2023-11-12 12:51 | 418K | |
| Characterization and..> | 2021-10-12 21:01 | 862K | |
| Channel equalization..> | 2021-10-12 20:36 | 754K | |
| Cascaded VCRS using ..> | 2023-11-21 12:09 | 868K | |
| Carbon nanotubes in ..> | 2021-11-24 14:42 | 602K | |
| Breast implant imagi..> | 2022-03-30 23:41 | 762K | |
| Biomechanical model ..> | 2022-01-07 13:42 | 1.2M | |
| Bicycle kinetic ener..> | 2021-10-12 15:18 | 517K | |
| BCI in classroom, sy..> | 2021-10-12 20:57 | 365K | |
| Automated plant wate..> | 2024-06-01 23:41 | 484K | |
| A survey on security..> | 2021-10-12 20:37 | 226K | |
| A study on unveiling..> | 2023-12-21 09:23 | 493K | |
| A study on remote se..> | 2022-02-23 19:40 | 1.1M | |
| Artificial implants ..> | 2023-08-06 14:02 | 577K | |
| A review of vocal tr..> | 2021-10-12 20:39 | 614K | |
| Applications of gsp-..> | 2021-10-12 20:44 | 333K | |
| Application of green..> | 2021-10-12 15:17 | 1.0M | |
| Antioxidant activity..> | 2021-10-12 20:52 | 448K | |
| An overview of green..> | 2024-04-12 11:53 | 312K | |
| An overview of biose..> | 2022-01-01 21:35 | 565K | |
| A novel methodology ..> | 2024-04-04 10:31 | 651K | |
| An improved algorith..> | 2021-10-12 20:53 | 244K | |
| An experimental stud..> | 2022-06-08 14:55 | 1.1M | |
| A new method combini..> | 2021-10-12 20:38 | 379K | |
| An efficient method ..> | 2021-10-12 20:54 | 355K | |
| An analysis of assoc..> | 2024-03-17 15:23 | 422K | |
| Analyzing job shop s..> | 2021-10-12 20:56 | 585K | |
| Analysis of research..> | 2021-10-12 20:07 | 596K | |
| Algorithm for the ap..> | 2023-12-17 11:17 | 408K | |
| Aerodynamic performa..> | 2022-09-10 16:11 | 1.0M | |
| A critical review on..> | 2023-05-14 15:37 | 1.4M | |
| A critical review on..> | 2023-08-07 14:09 | 599K | |
| A critical review of..> | 2023-03-17 15:55 | 841K | |
| A comprehensive revi..> | 2023-05-31 15:45 | 831K | |
| A comprehensive revi..> | 2023-11-02 22:03 | 1.2M | |
| 1732358963_a90a8a3d5..> | 2024-11-23 16:19 | 4.0K | |
| 1732258312_39faa02b2..> | 2024-11-22 12:21 | 29K | |
| 1732258299_4d23855c1..> | 2024-11-22 12:21 | 259K | |
| 1732085551_9e29d577e..> | 2024-11-20 12:22 | 259K | |
| 1732085290_9396c663b..> | 2024-11-20 12:18 | 251K | |
| 1732085274_8d42395ee..> | 2024-11-20 12:17 | 108K | |
| 28, vol-1, issue-6.pdf | 2021-10-23 17:39 | 768K | |
| 9.pdf | 2021-10-23 18:34 | 513K | |
| 8.pdf | 2021-10-23 18:34 | 1.0M | |
| 7.pdf | 2021-10-23 18:34 | 519K | |
| 6.pdf | 2021-10-23 18:33 | 319K | |
| 5.pdf | 2021-10-23 18:33 | 763K | |
| 4.pdf | 2021-10-23 18:32 | 251K | |
| 2.pdf | 2023-01-19 12:09 | 432K | |
|
|---|
.jpg){kind=link}
